C2H2Cl2F2O4S — CID 162539021
1,1-dichloro-2,2-difluoro-2-hydroxyethanesulfonic acid (PubChem CID 162539021) has the molecular formula C2H2Cl2F2O4S and a molecular weight of 231.00 g/mol. Its IUPAC name is 1,1-dichloro-2,2-difluoro-2-hydroxyethanesulfonic acid.
| Compound Name | 1,1-dichloro-2,2-difluoro-2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 162539021 |
| Molecular Formula | C2H2Cl2F2O4S |
| Molecular Weight | 231.00 g/mol |
| Exact Mass | 229.90 |
| IUPAC Name | 1,1-dichloro-2,2-difluoro-2-hydroxyethanesulfonic acid |
| SMILES | O=S(=O)(O)C(Cl)(Cl)C(O)(F)F |
| InChI | InChI=1S/C2H2Cl2F2O4S/c3-1(4,2(5,6)7)11(8,9)10/h7H,(H,8,9,10) |
| InChIKey | QXHFKDJXEDXSQN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.00 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|