C12H3ClF20O2 — CID 88826729
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11-icosafluoroundecyl carbonochloridate (PubChem CID 88826729) has the molecular formula C12H3ClF20O2 and a molecular weight of 594.57 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11-icosafluoroundecyl carbonochloridate.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11-icosafluoroundecyl carbonochloridate |
|---|---|
| PubChem CID | 88826729 |
| Molecular Formula | C12H3ClF20O2 |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 593.95 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11-icosafluoroundecyl carbonochloridate |
| SMILES | O=C(Cl)OC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C12H3ClF20O2/c13-4(34)35-3(17)6(20,21)8(24,25)10(28,29)12(32,33)11(30,31)9(26,27)7(22,23)5(18,19)1(14)2(15)16/h1-3H |
| InChIKey | LDBBMKIBOTZSNN-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|