C9HClF16O2 — CID 87686124
1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl carbonochloridate (PubChem CID 87686124) has the molecular formula C9HClF16O2 and a molecular weight of 480.53 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl carbonochloridate.
| Compound Name | 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl carbonochloridate |
|---|---|
| PubChem CID | 87686124 |
| Molecular Formula | C9HClF16O2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl carbonochloridate |
| SMILES | O=C(Cl)OC(F)(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9HClF16O2/c10-2(27)28-4(14,15)1(11)3(12,13)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h1H |
| InChIKey | BQOGPCKEJBZWQZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|