C8H4F12O3 — CID 71425836
2-(1,1,2,3,3,4,4,5,5,6,6,6-dodecafluorohexoxy)acetic acid (PubChem CID 71425836) has the molecular formula C8H4F12O3 and a molecular weight of 376.09 g/mol. Its IUPAC name is 2-(1,1,2,3,3,4,4,5,5,6,6,6-dodecafluorohexoxy)acetic acid.
| Compound Name | 2-(1,1,2,3,3,4,4,5,5,6,6,6-dodecafluorohexoxy)acetic acid |
|---|---|
| PubChem CID | 71425836 |
| Molecular Formula | C8H4F12O3 |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 2-(1,1,2,3,3,4,4,5,5,6,6,6-dodecafluorohexoxy)acetic acid |
| SMILES | O=C(O)COC(F)(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F12O3/c9-3(5(12,13)23-1-2(21)22)4(10,11)6(14,15)7(16,17)8(18,19)20/h3H,1H2,(H,21,22) |
| InChIKey | IHDYADYLSULBLI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|