C10H12F10NO2+ — CID 165364686
carboxymethyl-(2,3,3,4,4,5,5,6,6,6-decafluorohexyl)-dimethylazanium (PubChem CID 165364686) has the molecular formula C10H12F10NO2+ and a molecular weight of 368.19 g/mol. Its IUPAC name is carboxymethyl-(2,3,3,4,4,5,5,6,6,6-decafluorohexyl)-dimethylazanium.
| Compound Name | carboxymethyl-(2,3,3,4,4,5,5,6,6,6-decafluorohexyl)-dimethylazanium |
|---|---|
| PubChem CID | 165364686 |
| Molecular Formula | C10H12F10NO2+ |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | carboxymethyl-(2,3,3,4,4,5,5,6,6,6-decafluorohexyl)-dimethylazanium |
| SMILES | C[N+](C)(CC(=O)O)CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F10NO2/c1-21(2,4-6(22)23)3-5(11)7(12,13)8(14,15)9(16,17)10(18,19)20/h5H,3-4H2,1-2H3/p+1 |
| InChIKey | WCUKRNAORCYLLN-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|