3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid

C10H11F7O4 — CID 87355701

IUPAC3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid
SMILESCC(C)(C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)CC(=O)O
InChIInChI=1S/C10H11F7O4/c1-7(2,6(20)21)9(14,15)10(16,17)8(12,13)4(11)3-5(18)19/h4H,3H2,1-2H3,(H,18,19)(H,20,21)
InChIKeyVODJITNXTZGZBL-UHFFFAOYSA-N
MW328.18 g/mol
LogP2.82
Rot. Bonds7

About 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid

3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid (PubChem CID 87355701) has the molecular formula C10H11F7O4 and a molecular weight of 328.18 g/mol. Its IUPAC name is 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid.

Molecular Properties

Compound Name3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid
PubChem CID87355701
Molecular FormulaC10H11F7O4
Molecular Weight328.18 g/mol
Exact Mass328.05
IUPAC Name3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid
SMILESCC(C)(C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)CC(=O)O
InChIInChI=1S/C10H11F7O4/c1-7(2,6(20)21)9(14,15)10(16,17)8(12,13)4(11)3-5(18)19/h4H,3H2,1-2H3,(H,18,19)(H,20,21)
InChIKeyVODJITNXTZGZBL-UHFFFAOYSA-N
XLogP2.82
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.18
LogP ≤ 52.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid?
The IUPAC name of 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid (CID 87355701) is 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid.
What is the SMILES notation for 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid?
The canonical SMILES for 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid is CC(C)(C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)CC(=O)O.
What is the InChIKey of 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid?
The InChIKey is VODJITNXTZGZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F7O4/c1-7(2,6(20)21)9(14,15)10(16,17)8(12,13)4(11)3-5(18)19/h4H,3H2,1-2H3,(H,18,19)(H,20,21).
What are the key properties of 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid?
3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid has a molecular weight of 328.18 g/mol, XLogP of 2.82, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid is sourced from PubChem (CID 87355701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).