C10H11F7O4 — CID 87355701
3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid (PubChem CID 87355701) has the molecular formula C10H11F7O4 and a molecular weight of 328.18 g/mol. Its IUPAC name is 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid.
| Compound Name | 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid |
|---|---|
| PubChem CID | 87355701 |
| Molecular Formula | C10H11F7O4 |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 3,3,4,4,5,5,6-heptafluoro-2,2-dimethyloctanedioic acid |
| SMILES | CC(C)(C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)CC(=O)O |
| InChI | InChI=1S/C10H11F7O4/c1-7(2,6(20)21)9(14,15)10(16,17)8(12,13)4(11)3-5(18)19/h4H,3H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | VODJITNXTZGZBL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|