C9H4F14O5 — CID 162396615
2-[1,1,2-trifluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]acetic acid (PubChem CID 162396615) has the molecular formula C9H4F14O5 and a molecular weight of 458.10 g/mol. Its IUPAC name is 2-[1,1,2-trifluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[1,1,2-trifluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 162396615 |
| Molecular Formula | C9H4F14O5 |
| Molecular Weight | 458.10 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | 2-[1,1,2-trifluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COC(F)(F)C(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F14O5/c10-3(4(11,12)26-1-2(24)25)27-8(20,21)9(22,23)28-7(18,19)5(13,14)6(15,16)17/h3H,1H2,(H,24,25) |
| InChIKey | XLWPSCROLZWCFY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.10 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|