C8H2F14O4 — CID 162396535
2-fluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]acetic acid (PubChem CID 162396535) has the molecular formula C8H2F14O4 and a molecular weight of 428.07 g/mol. Its IUPAC name is 2-fluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]acetic acid.
| Compound Name | 2-fluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]acetic acid |
|---|---|
| PubChem CID | 162396535 |
| Molecular Formula | C8H2F14O4 |
| Molecular Weight | 428.07 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 2-fluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]acetic acid |
| SMILES | O=C(O)C(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F14O4/c9-1(2(23)24)25-6(17,18)4(12,13)8(21,22)26-7(19,20)3(10,11)5(14,15)16/h1H,(H,23,24) |
| InChIKey | KNKREEYPFRYMBH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.07 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|