C6HF11O3 — CID 11659940
3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-hydroxypropanoyl fluoride (PubChem CID 11659940) has the molecular formula C6HF11O3 and a molecular weight of 330.05 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-hydroxypropanoyl fluoride.
| Compound Name | 3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-hydroxypropanoyl fluoride |
|---|---|
| PubChem CID | 11659940 |
| Molecular Formula | C6HF11O3 |
| Molecular Weight | 330.05 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-hydroxypropanoyl fluoride |
| SMILES | O=C(F)C(O)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6HF11O3/c7-1(18)2(19,4(10,11)12)20-6(16,17)3(8,9)5(13,14)15/h19H |
| InChIKey | RFILVFJNQPRXPH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.05 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|