C7F12O3 — CID 98047876
2,2,3,3,4,4-hexafluoro-4-[(2S)-1,1,1,2,3-pentafluoro-3-oxopropan-2-yl]oxybutanoyl fluoride (PubChem CID 98047876) has the molecular formula C7F12O3 and a molecular weight of 360.05 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-4-[(2S)-1,1,1,2,3-pentafluoro-3-oxopropan-2-yl]oxybutanoyl fluoride.
| Compound Name | 2,2,3,3,4,4-hexafluoro-4-[(2S)-1,1,1,2,3-pentafluoro-3-oxopropan-2-yl]oxybutanoyl fluoride |
|---|---|
| PubChem CID | 98047876 |
| Molecular Formula | C7F12O3 |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-4-[(2S)-1,1,1,2,3-pentafluoro-3-oxopropan-2-yl]oxybutanoyl fluoride |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)O[C@](F)(C(=O)F)C(F)(F)F |
| InChI | InChI=1S/C7F12O3/c8-1(20)3(10,11)5(13,14)7(18,19)22-4(12,2(9)21)6(15,16)17/t4-/m1/s1 |
| InChIKey | MNEZTIJYMZUPMM-SCSAIBSYSA-N |
| XLogP | 3.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|