C7H2F10O5 — CID 58623351
4-(1-carboxy-1,2,2,2-tetrafluoroethoxy)-2,2,3,3,4,4-hexafluorobutanoic acid (PubChem CID 58623351) has the molecular formula C7H2F10O5 and a molecular weight of 356.07 g/mol. Its IUPAC name is 4-(1-carboxy-1,2,2,2-tetrafluoroethoxy)-2,2,3,3,4,4-hexafluorobutanoic acid.
| Compound Name | 4-(1-carboxy-1,2,2,2-tetrafluoroethoxy)-2,2,3,3,4,4-hexafluorobutanoic acid |
|---|---|
| PubChem CID | 58623351 |
| Molecular Formula | C7H2F10O5 |
| Molecular Weight | 356.07 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 4-(1-carboxy-1,2,2,2-tetrafluoroethoxy)-2,2,3,3,4,4-hexafluorobutanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C7H2F10O5/c8-3(9,1(18)19)5(11,12)7(16,17)22-4(10,2(20)21)6(13,14)15/h(H,18,19)(H,20,21) |
| InChIKey | DCCIZEOSAOZSJB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.07 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|