C6H2F8O5 — CID 11484889
2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-2,3,3,3-tetrafluoropropanoic acid (PubChem CID 11484889) has the molecular formula C6H2F8O5 and a molecular weight of 306.06 g/mol. Its IUPAC name is 2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-2,3,3,3-tetrafluoropropanoic acid.
| Compound Name | 2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-2,3,3,3-tetrafluoropropanoic acid |
|---|---|
| PubChem CID | 11484889 |
| Molecular Formula | C6H2F8O5 |
| Molecular Weight | 306.06 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-2,3,3,3-tetrafluoropropanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)OC(F)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C6H2F8O5/c7-3(8,1(15)16)6(13,14)19-4(9,2(17)18)5(10,11)12/h(H,15,16)(H,17,18) |
| InChIKey | IWWYDBCKRGDWIN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.06 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|