C12H2F20O5 — CID 87472249
2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,3-tetrafluoroprop-2-enoxy)propoxy]propoxy]propanoic acid (PubChem CID 87472249) has the molecular formula C12H2F20O5 and a molecular weight of 606.10 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,3-tetrafluoroprop-2-enoxy)propoxy]propoxy]propanoic acid.
| Compound Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,3-tetrafluoroprop-2-enoxy)propoxy]propoxy]propanoic acid |
|---|---|
| PubChem CID | 87472249 |
| Molecular Formula | C12H2F20O5 |
| Molecular Weight | 606.10 g/mol |
| Exact Mass | 605.96 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,3-tetrafluoroprop-2-enoxy)propoxy]propoxy]propanoic acid |
| SMILES | O=C(O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)=CF)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H2F20O5/c13-1-2(14)5(16,17)36-6(18,9(23,24)25)12(31,32)37-7(19,10(26,27)28)11(29,30)35-4(15,3(33)34)8(20,21)22/h1H,(H,33,34) |
| InChIKey | XZQUNIQZLUROKC-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.10 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |