C10F18O4 — CID 175754670
2,2,3,3,4,4-hexafluoro-4-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,3-pentafluoro-3-oxopropan-2-yl)oxypropan-2-yl]oxybutanoyl fluoride (PubChem CID 175754670) has the molecular formula C10F18O4 and a molecular weight of 526.07 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-4-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,3-pentafluoro-3-oxopropan-2-yl)oxypropan-2-yl]oxybutanoyl fluoride.
| Compound Name | 2,2,3,3,4,4-hexafluoro-4-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,3-pentafluoro-3-oxopropan-2-yl)oxypropan-2-yl]oxybutanoyl fluoride |
|---|---|
| PubChem CID | 175754670 |
| Molecular Formula | C10F18O4 |
| Molecular Weight | 526.07 g/mol |
| Exact Mass | 525.95 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-4-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,3-pentafluoro-3-oxopropan-2-yl)oxypropan-2-yl]oxybutanoyl fluoride |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(C(=O)F)C(F)(F)F |
| InChI | InChI=1S/C10F18O4/c11-1(29)3(13,14)5(16,17)9(25,26)32-6(18,8(22,23)24)10(27,28)31-4(15,2(12)30)7(19,20)21 |
| InChIKey | VPYYABKODQRVDY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.07 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|