C5F9IO2 — CID 11696776
2,3,3,3-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propanoyl fluoride (PubChem CID 11696776) has the molecular formula C5F9IO2 and a molecular weight of 389.94 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propanoyl fluoride.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propanoyl fluoride |
|---|---|
| PubChem CID | 11696776 |
| Molecular Formula | C5F9IO2 |
| Molecular Weight | 389.94 g/mol |
| Exact Mass | 389.88 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propanoyl fluoride |
| SMILES | O=C(F)C(F)(OC(F)(F)C(F)(F)I)C(F)(F)F |
| InChI | InChI=1S/C5F9IO2/c6-1(16)2(7,3(8,9)10)17-5(13,14)4(11,12)15 |
| InChIKey | FQYKOTVFONPAAI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.94 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|