C9F18O2 — CID 175734920
2-[1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-3-yl]oxy-2,3,3,3-tetrafluoropropanoyl fluoride (PubChem CID 175734920) has the molecular formula C9F18O2 and a molecular weight of 482.06 g/mol. Its IUPAC name is 2-[1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-3-yl]oxy-2,3,3,3-tetrafluoropropanoyl fluoride.
| Compound Name | 2-[1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-3-yl]oxy-2,3,3,3-tetrafluoropropanoyl fluoride |
|---|---|
| PubChem CID | 175734920 |
| Molecular Formula | C9F18O2 |
| Molecular Weight | 482.06 g/mol |
| Exact Mass | 481.96 |
| IUPAC Name | 2-[1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-3-yl]oxy-2,3,3,3-tetrafluoropropanoyl fluoride |
| SMILES | O=C(F)C(F)(OC(F)(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9F18O2/c10-1(28)2(11,6(16,17)18)29-5(15,4(13,14)9(25,26)27)3(12,7(19,20)21)8(22,23)24 |
| InChIKey | GWKRSEXPHQPORJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.06 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|