C5BrF9O2 — CID 98454810
(2S)-2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-2,3,3,3-tetrafluoropropanoyl fluoride (PubChem CID 98454810) has the molecular formula C5BrF9O2 and a molecular weight of 342.94 g/mol. Its IUPAC name is (2S)-2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-2,3,3,3-tetrafluoropropanoyl fluoride.
| Compound Name | (2S)-2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-2,3,3,3-tetrafluoropropanoyl fluoride |
|---|---|
| PubChem CID | 98454810 |
| Molecular Formula | C5BrF9O2 |
| Molecular Weight | 342.94 g/mol |
| Exact Mass | 341.89 |
| IUPAC Name | (2S)-2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-2,3,3,3-tetrafluoropropanoyl fluoride |
| SMILES | O=C(F)[C@@](F)(OC(F)(F)C(F)(F)Br)C(F)(F)F |
| InChI | InChI=1S/C5BrF9O2/c6-3(9,10)5(14,15)17-2(8,1(7)16)4(11,12)13/t2-/m1/s1 |
| InChIKey | COIQPZUVUUGETI-UWTATZPHSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.94 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|