C7H4F13NO3 — CID 138396479
azanium 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)propanoate (PubChem CID 138396479) has the molecular formula C7H4F13NO3 and a molecular weight of 397.09 g/mol. Its IUPAC name is azanium 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)propanoate.
| Compound Name | azanium 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)propanoate |
|---|---|
| PubChem CID | 138396479 |
| Molecular Formula | C7H4F13NO3 |
| Molecular Weight | 397.09 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | azanium 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)propanoate |
| SMILES | O=C([O-])C(F)(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F.[NH4+] |
| InChI | InChI=1S/C7HF13O3.H3N/c8-2(1(21)22,5(13,14)15)23-7(19,20)4(11,12)3(9,10)6(16,17)18;/h(H,21,22);1H3 |
| InChIKey | QFICKAQEFXZVIZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.09 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|