C16F30O4 — CID 88530414
1,1,1,2,4,5,5,5-octafluoro-2-[1,1,2,2,3,3,4,4-octafluoro-4-[1,1,1,2,4,5,5,5-octafluoro-3-oxo-4-(trifluoromethyl)pentan-2-yl]oxybutoxy]-4-(trifluoromethyl)pentan-3-one (PubChem CID 88530414) has the molecular formula C16F30O4 and a molecular weight of 826.11 g/mol. Its IUPAC name is 1,1,1,2,4,5,5,5-octafluoro-2-[1,1,2,2,3,3,4,4-octafluoro-4-[1,1,1,2,4,5,5,5-octafluoro-3-oxo-4-(trifluoromethyl)pentan-2-yl]oxybutoxy]-4-(trifluoromethyl)pentan-3-one.
| Compound Name | 1,1,1,2,4,5,5,5-octafluoro-2-[1,1,2,2,3,3,4,4-octafluoro-4-[1,1,1,2,4,5,5,5-octafluoro-3-oxo-4-(trifluoromethyl)pentan-2-yl]oxybutoxy]-4-(trifluoromethyl)pentan-3-one |
|---|---|
| PubChem CID | 88530414 |
| Molecular Formula | C16F30O4 |
| Molecular Weight | 826.11 g/mol |
| Exact Mass | 825.93 |
| IUPAC Name | 1,1,1,2,4,5,5,5-octafluoro-2-[1,1,2,2,3,3,4,4-octafluoro-4-[1,1,1,2,4,5,5,5-octafluoro-3-oxo-4-(trifluoromethyl)pentan-2-yl]oxybutoxy]-4-(trifluoromethyl)pentan-3-one |
| SMILES | O=C(C(F)(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(=O)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16F30O4/c17-3(9(25,26)27,10(28,29)30)1(47)5(19,13(37,38)39)49-15(43,44)7(21,22)8(23,24)16(45,46)50-6(20,14(40,41)42)2(48)4(18,11(31,32)33)12(34,35)36 |
| InChIKey | LRRQBXBVAANOBK-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.11 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|