C10H2F18O2 — CID 88903032
1,1,1,2,4,5,5,5-octafluoro-2-(1,1,2,2,3,3,4-heptafluorobutoxy)-4-(trifluoromethyl)pentan-3-one (PubChem CID 88903032) has the molecular formula C10H2F18O2 and a molecular weight of 496.09 g/mol. Its IUPAC name is 1,1,1,2,4,5,5,5-octafluoro-2-(1,1,2,2,3,3,4-heptafluorobutoxy)-4-(trifluoromethyl)pentan-3-one.
| Compound Name | 1,1,1,2,4,5,5,5-octafluoro-2-(1,1,2,2,3,3,4-heptafluorobutoxy)-4-(trifluoromethyl)pentan-3-one |
|---|---|
| PubChem CID | 88903032 |
| Molecular Formula | C10H2F18O2 |
| Molecular Weight | 496.09 g/mol |
| Exact Mass | 495.98 |
| IUPAC Name | 1,1,1,2,4,5,5,5-octafluoro-2-(1,1,2,2,3,3,4-heptafluorobutoxy)-4-(trifluoromethyl)pentan-3-one |
| SMILES | O=C(C(F)(OC(F)(F)C(F)(F)C(F)(F)CF)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H2F18O2/c11-1-3(12,13)6(16,17)10(27,28)30-5(15,9(24,25)26)2(29)4(14,7(18,19)20)8(21,22)23/h1H2 |
| InChIKey | LNUKZELISRYXAC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.09 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|