C5F9KO5S — CID 23694417
potassium 2,3,3,3-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)propanoate (PubChem CID 23694417) has the molecular formula C5F9KO5S and a molecular weight of 382.20 g/mol. Its IUPAC name is potassium 2,3,3,3-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)propanoate.
| Compound Name | potassium 2,3,3,3-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)propanoate |
|---|---|
| PubChem CID | 23694417 |
| Molecular Formula | C5F9KO5S |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.90 |
| IUPAC Name | potassium 2,3,3,3-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)propanoate |
| SMILES | O=C([O-])C(F)(OC(F)(F)C(F)(F)S(=O)(=O)F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C5HF9O5S.K/c6-2(1(15)16,3(7,8)9)19-4(10,11)5(12,13)20(14,17)18;/h(H,15,16);/q;+1/p-1 |
| InChIKey | VZXARXSRFXSFRI-UHFFFAOYSA-M |
| XLogP | -2.53 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|