C6H2F9NaO5S — CID 159122574
sodium 3,3,4,4-tetrafluoro-4-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)butanoate (PubChem CID 159122574) has the molecular formula C6H2F9NaO5S and a molecular weight of 380.12 g/mol. Its IUPAC name is sodium 3,3,4,4-tetrafluoro-4-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)butanoate.
| Compound Name | sodium 3,3,4,4-tetrafluoro-4-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)butanoate |
|---|---|
| PubChem CID | 159122574 |
| Molecular Formula | C6H2F9NaO5S |
| Molecular Weight | 380.12 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | sodium 3,3,4,4-tetrafluoro-4-(1,1,2,2-tetrafluoro-2-fluorosulfonylethoxy)butanoate |
| SMILES | O=C([O-])CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)F.[Na+] |
| InChI | InChI=1S/C6H3F9O5S.Na/c7-3(8,1-2(16)17)4(9,10)20-5(11,12)6(13,14)21(15,18)19;/h1H2,(H,16,17);/q;+1/p-1 |
| InChIKey | UZZFJYVVUMJBOU-UHFFFAOYSA-M |
| XLogP | -2.14 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.12 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|