C10F14O3S — CID 101047010
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,4,5,6-pentafluorophenyl)ethoxy]ethanesulfonyl fluoride (PubChem CID 101047010) has the molecular formula C10F14O3S and a molecular weight of 466.15 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,4,5,6-pentafluorophenyl)ethoxy]ethanesulfonyl fluoride.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,4,5,6-pentafluorophenyl)ethoxy]ethanesulfonyl fluoride |
|---|---|
| PubChem CID | 101047010 |
| Molecular Formula | C10F14O3S |
| Molecular Weight | 466.15 g/mol |
| Exact Mass | 465.93 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,4,5,6-pentafluorophenyl)ethoxy]ethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10F14O3S/c11-2-1(3(12)5(14)6(15)4(2)13)7(16,17)8(18,19)27-9(20,21)10(22,23)28(24,25)26 |
| InChIKey | VQUHIFIFAZWUIB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.15 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|