C5H2F10O3S — CID 158210089
1,1,2,2-tetrafluoro-2-(1,1,2,2,3-pentafluoropropoxy)ethanesulfonyl fluoride (PubChem CID 158210089) has the molecular formula C5H2F10O3S and a molecular weight of 332.12 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(1,1,2,2,3-pentafluoropropoxy)ethanesulfonyl fluoride.
| Compound Name | 1,1,2,2-tetrafluoro-2-(1,1,2,2,3-pentafluoropropoxy)ethanesulfonyl fluoride |
|---|---|
| PubChem CID | 158210089 |
| Molecular Formula | C5H2F10O3S |
| Molecular Weight | 332.12 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(1,1,2,2,3-pentafluoropropoxy)ethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C5H2F10O3S/c6-1-2(7,8)3(9,10)18-4(11,12)5(13,14)19(15,16)17/h1H2 |
| InChIKey | FEYVYMDKKIHEIW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.12 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|