C17F28O — CID 101047022
1,2,3,4,5-pentafluoro-6-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]benzene (PubChem CID 101047022) has the molecular formula C17F28O and a molecular weight of 752.13 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]benzene |
|---|---|
| PubChem CID | 101047022 |
| Molecular Formula | C17F28O |
| Molecular Weight | 752.13 g/mol |
| Exact Mass | 751.95 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]benzene |
| SMILES | Fc1c(F)c(F)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C17F28O/c18-2-1(3(19)5(21)6(22)4(2)20)7(23,24)8(25,26)9(27,28)10(29,30)11(31,32)12(33,34)13(35,36)17(44,45)46-14(37,15(38,39)40)16(41,42)43 |
| InChIKey | RLJLFUMPCGHKEV-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.13 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|