C13H13F15O — CID 168817953
1,1,2,2,3,3,4,4-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)-7,7-dimethyloctane (PubChem CID 168817953) has the molecular formula C13H13F15O and a molecular weight of 470.22 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)-7,7-dimethyloctane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)-7,7-dimethyloctane |
|---|---|
| PubChem CID | 168817953 |
| Molecular Formula | C13H13F15O |
| Molecular Weight | 470.22 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)-7,7-dimethyloctane |
| SMILES | CC(C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F15O/c1-6(2,3)4-5-7(14,15)8(16,17)9(18,19)13(27,28)29-10(20,11(21,22)23)12(24,25)26/h4-5H2,1-3H3 |
| InChIKey | SEFZOFXARRZKHS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.22 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|