C12H6F20O3 — CID 118124202
1,1,1,2,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]ethoxy]butane (PubChem CID 118124202) has the molecular formula C12H6F20O3 and a molecular weight of 578.14 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]ethoxy]butane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]ethoxy]butane |
|---|---|
| PubChem CID | 118124202 |
| Molecular Formula | C12H6F20O3 |
| Molecular Weight | 578.14 g/mol |
| Exact Mass | 578.00 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]ethoxy]butane |
| SMILES | CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(C(C)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H6F20O3/c1-3(13,14)6(19,7(20,21)22)33-11(29,30)12(31,32)35-10(27,28)5(17,18)9(25,26)34-8(23,24)4(2,15)16/h1-2H3 |
| InChIKey | JUKUXLDZUFMCSX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.14 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|