C15H6F26O5 — CID 89491520
1-[difluoro(1,1,2,2-tetrafluoropropoxy)methoxy]-1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]ethoxy]propane (PubChem CID 89491520) has the molecular formula C15H6F26O5 and a molecular weight of 760.16 g/mol. Its IUPAC name is 1-[difluoro(1,1,2,2-tetrafluoropropoxy)methoxy]-1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]ethoxy]propane.
| Compound Name | 1-[difluoro(1,1,2,2-tetrafluoropropoxy)methoxy]-1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]ethoxy]propane |
|---|---|
| PubChem CID | 89491520 |
| Molecular Formula | C15H6F26O5 |
| Molecular Weight | 760.16 g/mol |
| Exact Mass | 759.98 |
| IUPAC Name | 1-[difluoro(1,1,2,2-tetrafluoropropoxy)methoxy]-1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]ethoxy]propane |
| SMILES | CC(F)(F)C(F)(F)OC(F)(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(C)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H6F26O5/c1-3(16,17)8(26,27)43-10(30,31)5(20,21)11(32,33)44-14(38,39)13(36,37)42-6(22,7(23,24)25)12(34,35)46-15(40,41)45-9(28,29)4(2,18)19/h1-2H3 |
| InChIKey | HHKCJVNQYWURID-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.16 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|