C11H3F21O4 — CID 19878587
2-[difluoro-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)propoxy]methoxy]-2,3,3,3-tetrafluoropropan-1-ol (PubChem CID 19878587) has the molecular formula C11H3F21O4 and a molecular weight of 598.10 g/mol. Its IUPAC name is 2-[difluoro-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)propoxy]methoxy]-2,3,3,3-tetrafluoropropan-1-ol.
| Compound Name | 2-[difluoro-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)propoxy]methoxy]-2,3,3,3-tetrafluoropropan-1-ol |
|---|---|
| PubChem CID | 19878587 |
| Molecular Formula | C11H3F21O4 |
| Molecular Weight | 598.10 g/mol |
| Exact Mass | 597.97 |
| IUPAC Name | 2-[difluoro-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)propoxy]methoxy]-2,3,3,3-tetrafluoropropan-1-ol |
| SMILES | OCC(F)(OC(F)(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H3F21O4/c12-2(1-33,6(18,19)20)34-11(31,32)36-10(29,30)5(17,8(24,25)26)35-9(27,28)4(15,16)3(13,14)7(21,22)23/h33H,1H2 |
| InChIKey | GPUJLCUCVWCJSM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.10 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|