C12H7F19O4 — CID 151641249
4,5,5,5-tetrafluoro-4-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethoxy)propoxy]propoxy]pentan-1-ol (PubChem CID 151641249) has the molecular formula C12H7F19O4 and a molecular weight of 576.15 g/mol. Its IUPAC name is 4,5,5,5-tetrafluoro-4-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethoxy)propoxy]propoxy]pentan-1-ol.
| Compound Name | 4,5,5,5-tetrafluoro-4-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethoxy)propoxy]propoxy]pentan-1-ol |
|---|---|
| PubChem CID | 151641249 |
| Molecular Formula | C12H7F19O4 |
| Molecular Weight | 576.15 g/mol |
| Exact Mass | 576.00 |
| IUPAC Name | 4,5,5,5-tetrafluoro-4-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethoxy)propoxy]propoxy]pentan-1-ol |
| SMILES | OCCCC(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H7F19O4/c13-4(2-1-3-32,7(16,17)18)33-10(25,26)5(14,8(19,20)21)34-11(27,28)6(15,9(22,23)24)35-12(29,30)31/h32H,1-3H2 |
| InChIKey | QSOLOMSNGXKIBK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.15 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |