C6F13IO2 — CID 169224794
1,1,1,2,3,3-hexafluoro-3-(1,2,2,2-tetrafluoro-1-iodoethoxy)-2-(trifluoromethoxy)propane (PubChem CID 169224794) has the molecular formula C6F13IO2 and a molecular weight of 477.94 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(1,2,2,2-tetrafluoro-1-iodoethoxy)-2-(trifluoromethoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(1,2,2,2-tetrafluoro-1-iodoethoxy)-2-(trifluoromethoxy)propane |
|---|---|
| PubChem CID | 169224794 |
| Molecular Formula | C6F13IO2 |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.87 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(1,2,2,2-tetrafluoro-1-iodoethoxy)-2-(trifluoromethoxy)propane |
| SMILES | FC(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(I)C(F)(F)F |
| InChI | InChI=1S/C6F13IO2/c7-1(2(8,9)10,21-6(17,18)19)4(14,15)22-5(16,20)3(11,12)13 |
| InChIKey | CGMIAJBNBPPOFL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|