C9HF19O3 — CID 18671047
1,1,1,2,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethoxy)propoxy]-3-(1,2,2,2-tetrafluoroethoxy)propane (PubChem CID 18671047) has the molecular formula C9HF19O3 and a molecular weight of 518.07 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethoxy)propoxy]-3-(1,2,2,2-tetrafluoroethoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethoxy)propoxy]-3-(1,2,2,2-tetrafluoroethoxy)propane |
|---|---|
| PubChem CID | 18671047 |
| Molecular Formula | C9HF19O3 |
| Molecular Weight | 518.07 g/mol |
| Exact Mass | 517.96 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethoxy)propoxy]-3-(1,2,2,2-tetrafluoroethoxy)propane |
| SMILES | FC(OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9HF19O3/c10-1(2(11,12)13)29-7(22,23)3(14,5(16,17)18)30-8(24,25)4(15,6(19,20)21)31-9(26,27)28/h1H |
| InChIKey | XUIAQIJGBFRSAI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.07 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |