C5ClF10IO — CID 19917287
3-chloro-1,1,1,2,3,4,4-heptafluoro-2-iodo-4-(trifluoromethoxy)butane (PubChem CID 19917287) has the molecular formula C5ClF10IO and a molecular weight of 428.39 g/mol. Its IUPAC name is 3-chloro-1,1,1,2,3,4,4-heptafluoro-2-iodo-4-(trifluoromethoxy)butane.
| Compound Name | 3-chloro-1,1,1,2,3,4,4-heptafluoro-2-iodo-4-(trifluoromethoxy)butane |
|---|---|
| PubChem CID | 19917287 |
| Molecular Formula | C5ClF10IO |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 427.85 |
| IUPAC Name | 3-chloro-1,1,1,2,3,4,4-heptafluoro-2-iodo-4-(trifluoromethoxy)butane |
| SMILES | FC(F)(F)OC(F)(F)C(F)(Cl)C(F)(I)C(F)(F)F |
| InChI | InChI=1S/C5ClF10IO/c6-1(7,2(8,17)3(9,10)11)4(12,13)18-5(14,15)16 |
| InChIKey | JDRNWOWTOOAPBG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|