C5Cl3F9O — CID 102345712
1,2-dichloro-3-(2-chloro-1,1,2,2-tetrafluoroethoxy)-1,1,2,3,3-pentafluoropropane (PubChem CID 102345712) has the molecular formula C5Cl3F9O and a molecular weight of 353.40 g/mol. Its IUPAC name is 1,2-dichloro-3-(2-chloro-1,1,2,2-tetrafluoroethoxy)-1,1,2,3,3-pentafluoropropane.
| Compound Name | 1,2-dichloro-3-(2-chloro-1,1,2,2-tetrafluoroethoxy)-1,1,2,3,3-pentafluoropropane |
|---|---|
| PubChem CID | 102345712 |
| Molecular Formula | C5Cl3F9O |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 351.89 |
| IUPAC Name | 1,2-dichloro-3-(2-chloro-1,1,2,2-tetrafluoroethoxy)-1,1,2,3,3-pentafluoropropane |
| SMILES | FC(F)(Cl)C(F)(F)OC(F)(F)C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C5Cl3F9O/c6-1(9,2(7,10)11)4(14,15)18-5(16,17)3(8,12)13 |
| InChIKey | HGRKHGJMXJWNLF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|