C12ClF24O4- — CID 163408241
1-[1-[1-(2-chloro-1,1,2,3,3,3-hexafluoropropoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoropropan-2-olate (PubChem CID 163408241) has the molecular formula C12ClF24O4- and a molecular weight of 699.53 g/mol. Its IUPAC name is 1-[1-[1-(2-chloro-1,1,2,3,3,3-hexafluoropropoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoropropan-2-olate.
| Compound Name | 1-[1-[1-(2-chloro-1,1,2,3,3,3-hexafluoropropoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoropropan-2-olate |
|---|---|
| PubChem CID | 163408241 |
| Molecular Formula | C12ClF24O4- |
| Molecular Weight | 699.53 g/mol |
| Exact Mass | 698.91 |
| IUPAC Name | 1-[1-[1-(2-chloro-1,1,2,3,3,3-hexafluoropropoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoropropan-2-olate |
| SMILES | [O-]C(F)(C(F)(F)F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(F)C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C12ClF24O4/c13-1(14,5(18,19)20)9(30,31)41-12(36,37)4(17,8(27,28)29)40-11(34,35)3(16,7(24,25)26)39-10(32,33)2(15,38)6(21,22)23/q-1 |
| InChIKey | RSBHTONXJQJJBF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|