C10H7F15O2 — CID 171431116
1,1,2,2-tetrafluoro-1-[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxy-3-methylbutane (PubChem CID 171431116) has the molecular formula C10H7F15O2 and a molecular weight of 444.13 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxy-3-methylbutane.
| Compound Name | 1,1,2,2-tetrafluoro-1-[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxy-3-methylbutane |
|---|---|
| PubChem CID | 171431116 |
| Molecular Formula | C10H7F15O2 |
| Molecular Weight | 444.13 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxy-3-methylbutane |
| SMILES | CC(C)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F15O2/c1-3(2)4(11,12)8(20,21)26-5(13,6(14,15)16)9(22,23)27-10(24,25)7(17,18)19/h3H,1-2H3 |
| InChIKey | XPPWKNACFJXSLZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.13 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|