C7F15IO2 — CID 155982269
1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane (PubChem CID 155982269) has the molecular formula C7F15IO2 and a molecular weight of 527.95 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane |
|---|---|
| PubChem CID | 155982269 |
| Molecular Formula | C7F15IO2 |
| Molecular Weight | 527.95 g/mol |
| Exact Mass | 527.87 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane |
| SMILES | FC(F)(F)C(F)(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)I)C(F)(F)F |
| InChI | InChI=1S/C7F15IO2/c8-1(2(9,10)11,24-7(21,22)4(15,16)23)5(17,18)25-6(19,20)3(12,13)14 |
| InChIKey | JMZBFQOPUFEXGX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.95 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|