C8HClF14O4 — CID 102331882
2-[1-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2-difluoroacetic acid (PubChem CID 102331882) has the molecular formula C8HClF14O4 and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-[1-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2-difluoroacetic acid.
| Compound Name | 2-[1-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 102331882 |
| Molecular Formula | C8HClF14O4 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 461.93 |
| IUPAC Name | 2-[1-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2-difluoroacetic acid |
| SMILES | O=C(O)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)Cl |
| InChI | InChI=1S/C8HClF14O4/c9-5(14,15)3(12,6(16,17)18)27-8(22,23)4(13,7(19,20)21)26-2(10,11)1(24)25/h(H,24,25) |
| InChIKey | YSNPKFHYTGPTKW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|