C6ClF11O2 — CID 23236340
1-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,3,3,3-pentafluoropropan-2-one (PubChem CID 23236340) has the molecular formula C6ClF11O2 and a molecular weight of 348.50 g/mol. Its IUPAC name is 1-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,3,3,3-pentafluoropropan-2-one.
| Compound Name | 1-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,3,3,3-pentafluoropropan-2-one |
|---|---|
| PubChem CID | 23236340 |
| Molecular Formula | C6ClF11O2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | 1-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,3,3,3-pentafluoropropan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)Cl |
| InChI | InChI=1S/C6ClF11O2/c7-5(14,15)4(13,6(16,17)18)20-3(11,12)1(19)2(8,9)10 |
| InChIKey | WAJWYTPRFIJLNX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|