C3H4Cl2F4O3 — CID 157182838
1,1-dichloro-1,3,3,3-tetrafluoropropan-2-one;dihydrate (PubChem CID 157182838) has the molecular formula C3H4Cl2F4O3 and a molecular weight of 234.96 g/mol. Its IUPAC name is 1,1-dichloro-1,3,3,3-tetrafluoropropan-2-one;dihydrate.
| Compound Name | 1,1-dichloro-1,3,3,3-tetrafluoropropan-2-one;dihydrate |
|---|---|
| PubChem CID | 157182838 |
| Molecular Formula | C3H4Cl2F4O3 |
| Molecular Weight | 234.96 g/mol |
| Exact Mass | 233.95 |
| IUPAC Name | 1,1-dichloro-1,3,3,3-tetrafluoropropan-2-one;dihydrate |
| SMILES | O.O.O=C(C(F)(F)F)C(F)(Cl)Cl |
| InChI | InChI=1S/C3Cl2F4O.2H2O/c4-2(5,6)1(10)3(7,8)9;;/h;2*1H2 |
| InChIKey | AOTNOVKENAKLTQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.96 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|