C4H4Cl3F3N2O2 — CID 138558233
2,2,2-trichloroacetamide;2,2,2-trifluoroacetamide (PubChem CID 138558233) has the molecular formula C4H4Cl3F3N2O2 and a molecular weight of 275.44 g/mol. Its IUPAC name is 2,2,2-trichloroacetamide;2,2,2-trifluoroacetamide.
| Compound Name | 2,2,2-trichloroacetamide;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 138558233 |
| Molecular Formula | C4H4Cl3F3N2O2 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 273.93 |
| IUPAC Name | 2,2,2-trichloroacetamide;2,2,2-trifluoroacetamide |
| SMILES | NC(=O)C(Cl)(Cl)Cl.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C2H2Cl3NO.C2H2F3NO/c2*3-2(4,5)1(6)7/h2*(H2,6,7) |
| InChIKey | FDIUFFSNDUPEHR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|