C9H3Cl2F13O4 — CID 10624985
methyl 3-[1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate (PubChem CID 10624985) has the molecular formula C9H3Cl2F13O4 and a molecular weight of 493.00 g/mol. Its IUPAC name is methyl 3-[1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate.
| Compound Name | methyl 3-[1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 10624985 |
| Molecular Formula | C9H3Cl2F13O4 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 491.92 |
| IUPAC Name | methyl 3-[1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate |
| SMILES | COC(=O)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C9H3Cl2F13O4/c1-26-2(25)3(12,13)8(21,22)27-4(14,7(18,19)20)9(23,24)28-6(11,17)5(10,15)16/h1H3 |
| InChIKey | DLQKBJJQDQIFNC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|