C15H8ClF13O5 — CID 10460231
methyl 3-[1-(1-chloro-1,2,2-trifluoro-2-phenoxyethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate (PubChem CID 10460231) has the molecular formula C15H8ClF13O5 and a molecular weight of 550.65 g/mol. Its IUPAC name is methyl 3-[1-(1-chloro-1,2,2-trifluoro-2-phenoxyethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate.
| Compound Name | methyl 3-[1-(1-chloro-1,2,2-trifluoro-2-phenoxyethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 10460231 |
| Molecular Formula | C15H8ClF13O5 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 549.99 |
| IUPAC Name | methyl 3-[1-(1-chloro-1,2,2-trifluoro-2-phenoxyethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate |
| SMILES | COC(=O)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(Cl)C(F)(F)Oc1ccccc1 |
| InChI | InChI=1S/C15H8ClF13O5/c1-31-8(30)9(17,18)13(24,25)33-10(19,12(21,22)23)14(26,27)34-11(16,20)15(28,29)32-7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | OEDDVKSEOYXABB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|