C10H4F19NO4 — CID 175893923
azane;2,2,3,4,4,4-hexafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]butanoic acid (PubChem CID 175893923) has the molecular formula C10H4F19NO4 and a molecular weight of 563.11 g/mol. Its IUPAC name is azane;2,2,3,4,4,4-hexafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]butanoic acid.
| Compound Name | azane;2,2,3,4,4,4-hexafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]butanoic acid |
|---|---|
| PubChem CID | 175893923 |
| Molecular Formula | C10H4F19NO4 |
| Molecular Weight | 563.11 g/mol |
| Exact Mass | 562.98 |
| IUPAC Name | azane;2,2,3,4,4,4-hexafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]butanoic acid |
| SMILES | N.O=C(O)C(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10HF19O4.H3N/c11-2(12,1(30)31)4(15,7(20,21)22)32-10(28,29)5(16,8(23,24)25)33-9(26,27)3(13,14)6(17,18)19;/h(H,30,31);1H3 |
| InChIKey | DSRWSGIFCPMBPT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.11 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|