C11ClF22O5- — CID 163408249
1-[1-[1-[1-(2-chloro-1,1,2,3,3,3-hexafluoropropoxy)-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethanolate (PubChem CID 163408249) has the molecular formula C11ClF22O5- and a molecular weight of 665.52 g/mol. Its IUPAC name is 1-[1-[1-[1-(2-chloro-1,1,2,3,3,3-hexafluoropropoxy)-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethanolate.
| Compound Name | 1-[1-[1-[1-(2-chloro-1,1,2,3,3,3-hexafluoropropoxy)-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethanolate |
|---|---|
| PubChem CID | 163408249 |
| Molecular Formula | C11ClF22O5- |
| Molecular Weight | 665.52 g/mol |
| Exact Mass | 664.91 |
| IUPAC Name | 1-[1-[1-[1-(2-chloro-1,1,2,3,3,3-hexafluoropropoxy)-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethoxy]-1,2,2,2-tetrafluoroethanolate |
| SMILES | [O-]C(F)(OC(F)(OC(F)(OC(F)(OC(F)(F)C(F)(Cl)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11ClF22O5/c12-1(13,2(14,15)16)7(29,30)36-9(32,4(20,21)22)38-11(34,6(26,27)28)39-10(33,5(23,24)25)37-8(31,35)3(17,18)19/q-1 |
| InChIKey | UCZAGBRPXHHMJE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|