C3ClF8NS — CID 23235075
(2-chloro-1,1,2,3,3,3-hexafluoropropyl)imino-difluoro-λ4-sulfane (PubChem CID 23235075) has the molecular formula C3ClF8NS and a molecular weight of 269.54 g/mol. Its IUPAC name is (2-chloro-1,1,2,3,3,3-hexafluoropropyl)imino-difluoro-λ4-sulfane.
| Compound Name | (2-chloro-1,1,2,3,3,3-hexafluoropropyl)imino-difluoro-λ4-sulfane |
|---|---|
| PubChem CID | 23235075 |
| Molecular Formula | C3ClF8NS |
| Molecular Weight | 269.54 g/mol |
| Exact Mass | 268.93 |
| IUPAC Name | (2-chloro-1,1,2,3,3,3-hexafluoropropyl)imino-difluoro-λ4-sulfane |
| SMILES | FS(F)=NC(F)(F)C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C3ClF8NS/c4-1(5,2(6,7)8)3(9,10)13-14(11)12 |
| InChIKey | RWGZHAAUSZWRPD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|