C5ClF9O2 — CID 23236291
(2-chloro-1,1,2,3,3,3-hexafluoropropyl) 2,2,2-trifluoroacetate (PubChem CID 23236291) has the molecular formula C5ClF9O2 and a molecular weight of 298.49 g/mol. Its IUPAC name is (2-chloro-1,1,2,3,3,3-hexafluoropropyl) 2,2,2-trifluoroacetate.
| Compound Name | (2-chloro-1,1,2,3,3,3-hexafluoropropyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 23236291 |
| Molecular Formula | C5ClF9O2 |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 297.94 |
| IUPAC Name | (2-chloro-1,1,2,3,3,3-hexafluoropropyl) 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(F)(F)C(F)(Cl)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5ClF9O2/c6-3(10,4(11,12)13)5(14,15)17-1(16)2(7,8)9 |
| InChIKey | BHPGPKYXBLYUHM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|