C4ClF7O2 — CID 154335503
(2-chloro-1,1,1,3,3,3-hexafluoropropan-2-yl) carbonofluoridate (PubChem CID 154335503) has the molecular formula C4ClF7O2 and a molecular weight of 248.48 g/mol. Its IUPAC name is (2-chloro-1,1,1,3,3,3-hexafluoropropan-2-yl) carbonofluoridate.
| Compound Name | (2-chloro-1,1,1,3,3,3-hexafluoropropan-2-yl) carbonofluoridate |
|---|---|
| PubChem CID | 154335503 |
| Molecular Formula | C4ClF7O2 |
| Molecular Weight | 248.48 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | (2-chloro-1,1,1,3,3,3-hexafluoropropan-2-yl) carbonofluoridate |
| SMILES | O=C(F)OC(Cl)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4ClF7O2/c5-2(3(7,8)9,4(10,11)12)14-1(6)13 |
| InChIKey | CWWFGRLVTFOIBF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|