C6H2F8O3 — CID 173484159
1,1,2,2,3,3,3-heptafluoropropyl 3-fluoro-3-oxopropanoate (PubChem CID 173484159) has the molecular formula C6H2F8O3 and a molecular weight of 274.06 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropyl 3-fluoro-3-oxopropanoate.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropyl 3-fluoro-3-oxopropanoate |
|---|---|
| PubChem CID | 173484159 |
| Molecular Formula | C6H2F8O3 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropyl 3-fluoro-3-oxopropanoate |
| SMILES | O=C(F)CC(=O)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H2F8O3/c7-2(15)1-3(16)17-6(13,14)4(8,9)5(10,11)12/h1H2 |
| InChIKey | ZQLZHMFXMHADKR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|