C6H8F7NO3 — CID 88759405
azane;1,1,2,2,3,3,3-heptafluoropropyl propaneperoxoate (PubChem CID 88759405) has the molecular formula C6H8F7NO3 and a molecular weight of 275.12 g/mol. Its IUPAC name is azane;1,1,2,2,3,3,3-heptafluoropropyl propaneperoxoate.
| Compound Name | azane;1,1,2,2,3,3,3-heptafluoropropyl propaneperoxoate |
|---|---|
| PubChem CID | 88759405 |
| Molecular Formula | C6H8F7NO3 |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | azane;1,1,2,2,3,3,3-heptafluoropropyl propaneperoxoate |
| SMILES | CCC(=O)OOC(F)(F)C(F)(F)C(F)(F)F.N |
| InChI | InChI=1S/C6H5F7O3.H3N/c1-2-3(14)15-16-6(12,13)4(7,8)5(9,10)11;/h2H2,1H3;1H3 |
| InChIKey | ONUCOYFFEOHONR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|